C23H27N3O6 — CID 70516094
(3S)-3-amino-3-[(2-amino-2-methylpropanoyl)carbamoyl]-2-benzyl-4-oxo-4-phenylmethoxybutanoic acid (PubChem CID 70516094) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is (3S)-3-amino-3-[(2-amino-2-methylpropanoyl)carbamoyl]-2-benzyl-4-oxo-4-phenylmethoxybutanoic acid.
| Compound Name | (3S)-3-amino-3-[(2-amino-2-methylpropanoyl)carbamoyl]-2-benzyl-4-oxo-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 70516094 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (3S)-3-amino-3-[(2-amino-2-methylpropanoyl)carbamoyl]-2-benzyl-4-oxo-4-phenylmethoxybutanoic acid |
| SMILES | CC(C)(N)C(=O)NC(=O)[C@](N)(C(=O)OCc1ccccc1)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H27N3O6/c1-22(2,24)19(29)26-20(30)23(25,21(31)32-14-16-11-7-4-8-12-16)17(18(27)28)13-15-9-5-3-6-10-15/h3-12,17H,13-14,24-25H2,1-2H3,(H,27,28)(H,26,29,30)/t17?,23-/m0/s1 |
| InChIKey | ILAVAMRGXWIWFG-VXLWULRPSA-N |
| XLogP | 0.75 |
| TPSA | 161.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|