About (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate
(5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate (PubChem CID 70517041) has the molecular formula C17H26N2O4
and a molecular weight of 322.40 g/mol. Its IUPAC name is (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate.
Molecular Properties
| Compound Name | (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate |
| PubChem CID | 70517041 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate |
| SMILES | CCc1ccc(OC(=O)OCCCCCN2CCOCC2)nc1 |
| InChI | InChI=1S/C17H26N2O4/c1-2-15-6-7-16(18-14-15)23-17(20)22-11-5-3-4-8-19-9-12-21-13-10-19/h6-7,14H,2-5,8-13H2,1H3 |
| InChIKey | XLHQOTHPUBVENO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate?
The IUPAC name of (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate (CID 70517041) is (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate.
What is the SMILES notation for (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate?
The canonical SMILES for (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate is CCc1ccc(OC(=O)OCCCCCN2CCOCC2)nc1.
What is the InChIKey of (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate?
The InChIKey is XLHQOTHPUBVENO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O4/c1-2-15-6-7-16(18-14-15)23-17(20)22-11-5-3-4-8-19-9-12-21-13-10-19/h6-7,14H,2-5,8-13H2,1H3.
What are the key properties of (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate?
(5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate has a molecular weight of 322.40 g/mol, XLogP of 2.66, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-2-pyridinyl) 5-morpholin-4-ylpentyl carbonate is sourced from PubChem (CID 70517041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).