About S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane
S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane (PubChem CID 142876359) has the molecular formula C20H27N3O3S
and a molecular weight of 389.52 g/mol. Its IUPAC name is S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane.
Molecular Properties
| Compound Name | S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane |
| PubChem CID | 142876359 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane |
| SMILES | CC.NSC(=O)c1ccc(Oc2ccc(CCN3CCOCC3)cc2)nc1 |
| InChI | InChI=1S/C18H21N3O3S.C2H6/c19-25-18(22)15-3-6-17(20-13-15)24-16-4-1-14(2-5-16)7-8-21-9-11-23-12-10-21;1-2/h1-6,13H,7-12,19H2;1-2H3 |
| InChIKey | WXPDSUPTHUMESV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane?
The IUPAC name of S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane (CID 142876359) is S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane.
What is the SMILES notation for S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane?
The canonical SMILES for S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane is CC.NSC(=O)c1ccc(Oc2ccc(CCN3CCOCC3)cc2)nc1.
What is the InChIKey of S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane?
The InChIKey is WXPDSUPTHUMESV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O3S.C2H6/c19-25-18(22)15-3-6-17(20-13-15)24-16-4-1-14(2-5-16)7-8-21-9-11-23-12-10-21;1-2/h1-6,13H,7-12,19H2;1-2H3.
What are the key properties of S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane?
S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane has a molecular weight of 389.52 g/mol, XLogP of 3.52, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for S-amino 6-[4-(2-morpholin-4-ylethyl)phenoxy]pyridine-3-carbothioate;ethane is sourced from PubChem (CID 142876359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).