C32H33N3O2 — CID 59729978
6-[4-[2-(4-benzhydrylpiperidin-1-yl)ethyl]phenoxy]pyridine-3-carboxamide (PubChem CID 59729978) has the molecular formula C32H33N3O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 6-[4-[2-(4-benzhydrylpiperidin-1-yl)ethyl]phenoxy]pyridine-3-carboxamide.
| Compound Name | 6-[4-[2-(4-benzhydrylpiperidin-1-yl)ethyl]phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59729978 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 6-[4-[2-(4-benzhydrylpiperidin-1-yl)ethyl]phenoxy]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(CCN3CCC(C(c4ccccc4)c4ccccc4)CC3)cc2)nc1 |
| InChI | InChI=1S/C32H33N3O2/c33-32(36)28-13-16-30(34-23-28)37-29-14-11-24(12-15-29)17-20-35-21-18-27(19-22-35)31(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-16,23,27,31H,17-22H2,(H2,33,36) |
| InChIKey | LNVDDSKTYRRMBM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |