C19H15ClO2 — CID 70517484
2-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)butanoic acid (PubChem CID 70517484) has the molecular formula C19H15ClO2 and a molecular weight of 310.78 g/mol. Its IUPAC name is 2-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)butanoic acid.
| Compound Name | 2-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)butanoic acid |
|---|---|
| PubChem CID | 70517484 |
| Molecular Formula | C19H15ClO2 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene)butanoic acid |
| SMILES | CCC(C(=O)O)=C1c2ccccc2C=Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H15ClO2/c1-2-15(19(21)22)18-16-6-4-3-5-12(16)7-8-13-9-10-14(20)11-17(13)18/h3-11H,2H2,1H3,(H,21,22) |
| InChIKey | PBJOUFJVAMLTHD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|