C20H39N3O — CID 70521752
4-[1-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one (PubChem CID 70521752) has the molecular formula C20H39N3O and a molecular weight of 337.55 g/mol. Its IUPAC name is 4-[1-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one.
| Compound Name | 4-[1-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one |
|---|---|
| PubChem CID | 70521752 |
| Molecular Formula | C20H39N3O |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.31 |
| IUPAC Name | 4-[1-(dodecylamino)ethyl]-7-methyl-3,6-dihydro-2H-1,4-diazepin-5-one |
| SMILES | CCCCCCCCCCCCNC(C)N1CCN=C(C)CC1=O |
| InChI | InChI=1S/C20H39N3O/c1-4-5-6-7-8-9-10-11-12-13-14-22-19(3)23-16-15-21-18(2)17-20(23)24/h19,22H,4-17H2,1-3H3 |
| InChIKey | SVPZJKVRQUHQST-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|