C33H43ClN4O3S — CID 70523190
1-[4-[2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethoxy]phenoxy]-1-[ethyl(methyl)amino]propan-2-ol (PubChem CID 70523190) has the molecular formula C33H43ClN4O3S and a molecular weight of 611.25 g/mol. Its IUPAC name is 1-[4-[2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethoxy]phenoxy]-1-[ethyl(methyl)amino]propan-2-ol.
| Compound Name | 1-[4-[2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethoxy]phenoxy]-1-[ethyl(methyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 70523190 |
| Molecular Formula | C33H43ClN4O3S |
| Molecular Weight | 611.25 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | 1-[4-[2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethoxy]phenoxy]-1-[ethyl(methyl)amino]propan-2-ol |
| SMILES | CCN(C)C(Oc1ccc(OCCN2CCN(CCCN3c4ccccc4Sc4ccc(Cl)cc43)CC2)cc1)C(C)O |
| InChI | InChI=1S/C33H43ClN4O3S/c1-4-35(3)33(25(2)39)41-28-13-11-27(12-14-28)40-23-22-37-20-18-36(19-21-37)16-7-17-38-29-8-5-6-9-31(29)42-32-15-10-26(34)24-30(32)38/h5-6,8-15,24-25,33,39H,4,7,16-23H2,1-3H3 |
| InChIKey | XEQQIUVNVOPDCN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 51.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.25 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|