C29H50N2O — CID 70523445
(2S,3S,5S,8S,9S,10S,13R,14S,16S)-10,13-dimethyl-2,16-di(piperidin-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 70523445) has the molecular formula C29H50N2O and a molecular weight of 442.73 g/mol. Its IUPAC name is (2S,3S,5S,8S,9S,10S,13R,14S,16S)-10,13-dimethyl-2,16-di(piperidin-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (2S,3S,5S,8S,9S,10S,13R,14S,16S)-10,13-dimethyl-2,16-di(piperidin-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 70523445 |
| Molecular Formula | C29H50N2O |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.39 |
| IUPAC Name | (2S,3S,5S,8S,9S,10S,13R,14S,16S)-10,13-dimethyl-2,16-di(piperidin-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](O)[C@@H](N5CCCCC5)C[C@@]43C)[C@@H]1C[C@H](N1CCCCC1)C2 |
| InChI | InChI=1S/C29H50N2O/c1-28-12-11-24-23(25(28)18-22(19-28)30-13-5-3-6-14-30)10-9-21-17-27(32)26(20-29(21,24)2)31-15-7-4-8-16-31/h21-27,32H,3-20H2,1-2H3/t21-,22-,23+,24-,25-,26-,27-,28+,29-/m0/s1 |
| InChIKey | OEMCFNHOKXRFJR-SQKNSEFDSA-N |
| XLogP | 5.71 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |