C31H52N2O2 — CID 57240478
[(8S,9R,10S,13R,14S)-10,13-dimethyl-2,16-di(piperidin-1-yl)-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate (PubChem CID 57240478) has the molecular formula C31H52N2O2 and a molecular weight of 484.77 g/mol. Its IUPAC name is [(8S,9R,10S,13R,14S)-10,13-dimethyl-2,16-di(piperidin-1-yl)-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate.
| Compound Name | [(8S,9R,10S,13R,14S)-10,13-dimethyl-2,16-di(piperidin-1-yl)-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 57240478 |
| Molecular Formula | C31H52N2O2 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.40 |
| IUPAC Name | [(8S,9R,10S,13R,14S)-10,13-dimethyl-2,16-di(piperidin-1-yl)-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-2-yl] acetate |
| SMILES | CC(=O)OC1(N2CCCCC2)CCC2CC[C@@H]3[C@@H](CC[C@]4(C)CC(N5CCCCC5)C[C@@H]34)[C@@]2(C)C1 |
| InChI | InChI=1S/C31H52N2O2/c1-23(34)35-31(33-18-8-5-9-19-33)15-12-24-10-11-26-27(30(24,3)22-31)13-14-29(2)21-25(20-28(26)29)32-16-6-4-7-17-32/h24-28H,4-22H2,1-3H3/t24?,25?,26-,27-,28+,29-,30+,31?/m1/s1 |
| InChIKey | OOHMMBZIDKLJMX-SGQMTKEESA-N |
| XLogP | 6.63 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |