C13H10N12O — CID 70523912
(1Z,4Z)-1,2,4,5-tetrakis(2H-triazol-4-yl)penta-1,4-dien-3-one (PubChem CID 70523912) has the molecular formula C13H10N12O and a molecular weight of 350.31 g/mol. Its IUPAC name is (1Z,4Z)-1,2,4,5-tetrakis(2H-triazol-4-yl)penta-1,4-dien-3-one.
| Compound Name | (1Z,4Z)-1,2,4,5-tetrakis(2H-triazol-4-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 70523912 |
| Molecular Formula | C13H10N12O |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (1Z,4Z)-1,2,4,5-tetrakis(2H-triazol-4-yl)penta-1,4-dien-3-one |
| SMILES | O=C(/C(=C\c1cn[nH]n1)c1cn[nH]n1)/C(=C\c1cn[nH]n1)c1cn[nH]n1 |
| InChI | InChI=1S/C13H10N12O/c26-13(9(11-5-16-24-20-11)1-7-3-14-22-18-7)10(12-6-17-25-21-12)2-8-4-15-23-19-8/h1-6H,(H,14,18,22)(H,15,19,23)(H,16,20,24)(H,17,21,25)/b9-1-,10-2- |
| InChIKey | HXPJNJXEUCQYHK-LNUNWCPQSA-N |
| XLogP | -0.49 |
| TPSA | 183.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|