C15H17N3O — CID 70415907
4,4-dimethyl-1-phenyl-2-(2H-triazol-4-yl)pent-1-en-3-one (PubChem CID 70415907) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 4,4-dimethyl-1-phenyl-2-(2H-triazol-4-yl)pent-1-en-3-one.
| Compound Name | 4,4-dimethyl-1-phenyl-2-(2H-triazol-4-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 70415907 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4,4-dimethyl-1-phenyl-2-(2H-triazol-4-yl)pent-1-en-3-one |
| SMILES | CC(C)(C)C(=O)C(=Cc1ccccc1)c1cn[nH]n1 |
| InChI | InChI=1S/C15H17N3O/c1-15(2,3)14(19)12(13-10-16-18-17-13)9-11-7-5-4-6-8-11/h4-10H,1-3H3,(H,16,17,18) |
| InChIKey | ZQGJACNLPBPMOV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|