C19H20OS — CID 101116225
S-tert-butyl (E)-2,3-diphenylprop-2-enethioate (PubChem CID 101116225) has the molecular formula C19H20OS and a molecular weight of 296.44 g/mol. Its IUPAC name is S-tert-butyl (E)-2,3-diphenylprop-2-enethioate.
| Compound Name | S-tert-butyl (E)-2,3-diphenylprop-2-enethioate |
|---|---|
| PubChem CID | 101116225 |
| Molecular Formula | C19H20OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | S-tert-butyl (E)-2,3-diphenylprop-2-enethioate |
| SMILES | CC(C)(C)SC(=O)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20OS/c1-19(2,3)21-18(20)17(16-12-8-5-9-13-16)14-15-10-6-4-7-11-15/h4-14H,1-3H3/b17-14+ |
| InChIKey | ONQCVOLCTWBHHU-SAPNQHFASA-N |
| XLogP | 5.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|