C20H33N2O6PS2 — CID 70524336
[butan-2-yl(diethoxyphosphinothioyl)sulfinamoyl]methyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)carbamic acid (PubChem CID 70524336) has the molecular formula C20H33N2O6PS2 and a molecular weight of 492.60 g/mol. Its IUPAC name is [butan-2-yl(diethoxyphosphinothioyl)sulfinamoyl]methyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)carbamic acid.
| Compound Name | [butan-2-yl(diethoxyphosphinothioyl)sulfinamoyl]methyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)carbamic acid |
|---|---|
| PubChem CID | 70524336 |
| Molecular Formula | C20H33N2O6PS2 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [butan-2-yl(diethoxyphosphinothioyl)sulfinamoyl]methyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)carbamic acid |
| SMILES | CCOP(=S)(OCC)N(C(C)CC)S(=O)CN(C(=O)O)c1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C20H33N2O6PS2/c1-7-15(4)22(29(30,26-8-2)27-9-3)31(25)14-21(19(23)24)17-12-10-11-16-13-20(5,6)28-18(16)17/h10-12,15H,7-9,13-14H2,1-6H3,(H,23,24) |
| InChIKey | IVNPJEUWPWCSDU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|