C15H23N2O7PS — CID 88730693
dimethoxyphosphorylmethylsulfinamoylmethyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)carbamic acid (PubChem CID 88730693) has the molecular formula C15H23N2O7PS and a molecular weight of 406.40 g/mol. Its IUPAC name is dimethoxyphosphorylmethylsulfinamoylmethyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)carbamic acid.
| Compound Name | dimethoxyphosphorylmethylsulfinamoylmethyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)carbamic acid |
|---|---|
| PubChem CID | 88730693 |
| Molecular Formula | C15H23N2O7PS |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | dimethoxyphosphorylmethylsulfinamoylmethyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)carbamic acid |
| SMILES | COP(=O)(CNS(=O)CN(C(=O)O)c1cccc2c1OC(C)(C)C2)OC |
| InChI | InChI=1S/C15H23N2O7PS/c1-15(2)8-11-6-5-7-12(13(11)24-15)17(14(18)19)10-26(21)16-9-25(20,22-3)23-4/h5-7,16H,8-10H2,1-4H3,(H,18,19) |
| InChIKey | RRTXKJQMSDNMLD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|