C28H36N2O2 — CID 70524385
N-[1-[2-(4-benzoylphenyl)propyl]piperidin-2-yl]cyclohexanecarboxamide (PubChem CID 70524385) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is N-[1-[2-(4-benzoylphenyl)propyl]piperidin-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[2-(4-benzoylphenyl)propyl]piperidin-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 70524385 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | N-[1-[2-(4-benzoylphenyl)propyl]piperidin-2-yl]cyclohexanecarboxamide |
| SMILES | CC(CN1CCCCC1NC(=O)C1CCCCC1)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H36N2O2/c1-21(22-15-17-24(18-16-22)27(31)23-10-4-2-5-11-23)20-30-19-9-8-14-26(30)29-28(32)25-12-6-3-7-13-25/h2,4-5,10-11,15-18,21,25-26H,3,6-9,12-14,19-20H2,1H3,(H,29,32) |
| InChIKey | JXGGPQLLQWLACF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |