C10H14N4O2S — CID 70529851
2-piperazin-2-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione (PubChem CID 70529851) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-piperazin-2-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione.
| Compound Name | 2-piperazin-2-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 70529851 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-piperazin-2-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione |
| SMILES | O=C1CC(=O)N2CC(C3CNCCN3)SC2=N1 |
| InChI | InChI=1S/C10H14N4O2S/c15-8-3-9(16)14-5-7(17-10(14)13-8)6-4-11-1-2-12-6/h6-7,11-12H,1-5H2 |
| InChIKey | JCPUYRBBDATGPL-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|