C16H21ClN2S — CID 70531771
2-methyl-3,4-dihydro-2H-pyrrole;2-(thiophen-2-ylmethyl)aniline;hydrochloride (PubChem CID 70531771) has the molecular formula C16H21ClN2S and a molecular weight of 308.88 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-pyrrole;2-(thiophen-2-ylmethyl)aniline;hydrochloride.
| Compound Name | 2-methyl-3,4-dihydro-2H-pyrrole;2-(thiophen-2-ylmethyl)aniline;hydrochloride |
|---|---|
| PubChem CID | 70531771 |
| Molecular Formula | C16H21ClN2S |
| Molecular Weight | 308.88 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-methyl-3,4-dihydro-2H-pyrrole;2-(thiophen-2-ylmethyl)aniline;hydrochloride |
| SMILES | CC1CCC=N1.Cl.Nc1ccccc1Cc1cccs1 |
| InChI | InChI=1S/C11H11NS.C5H9N.ClH/c12-11-6-2-1-4-9(11)8-10-5-3-7-13-10;1-5-3-2-4-6-5;/h1-7H,8,12H2;4-5H,2-3H2,1H3;1H |
| InChIKey | BTXKZEHRFVXUDQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|