About 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline
4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline (PubChem CID 70533583) has the molecular formula C27H32N2O2
and a molecular weight of 416.57 g/mol. Its IUPAC name is 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline.
Molecular Properties
| Compound Name | 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline |
| PubChem CID | 70533583 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline |
| SMILES | Cc1ccccc1O[C@H]1CCN(CCCOc2ccc(N)cc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H32N2O2/c1-21-8-5-6-11-26(21)31-27-16-18-29(20-25(27)22-9-3-2-4-10-22)17-7-19-30-24-14-12-23(28)13-15-24/h2-6,8-15,25,27H,7,16-20,28H2,1H3/t25-,27-/m0/s1 |
| InChIKey | GMVBMBAWQKJRHS-BDYUSTAISA-N |
| XLogP | 5.28 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline?
The IUPAC name of 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline (CID 70533583) is 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline.
What is the SMILES notation for 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline?
The canonical SMILES for 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline is Cc1ccccc1O[C@H]1CCN(CCCOc2ccc(N)cc2)C[C@H]1c1ccccc1.
What is the InChIKey of 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline?
The InChIKey is GMVBMBAWQKJRHS-BDYUSTAISA-N. The full InChI is InChI=1S/C27H32N2O2/c1-21-8-5-6-11-26(21)31-27-16-18-29(20-25(27)22-9-3-2-4-10-22)17-7-19-30-24-14-12-23(28)13-15-24/h2-6,8-15,25,27H,7,16-20,28H2,1H3/t25-,27-/m0/s1.
What are the key properties of 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline?
4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline has a molecular weight of 416.57 g/mol, XLogP of 5.28, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(3R,4S)-4-(2-methylphenoxy)-3-phenylpiperidin-1-yl]propoxy]aniline is sourced from PubChem (CID 70533583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).