C15H20ClN3O4 — CID 70534670
ethyl 3-(2-nitro-4-piperazin-2-ylphenyl)prop-2-enoate;hydrochloride (PubChem CID 70534670) has the molecular formula C15H20ClN3O4 and a molecular weight of 341.80 g/mol. Its IUPAC name is ethyl 3-(2-nitro-4-piperazin-2-ylphenyl)prop-2-enoate;hydrochloride.
| Compound Name | ethyl 3-(2-nitro-4-piperazin-2-ylphenyl)prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 70534670 |
| Molecular Formula | C15H20ClN3O4 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | ethyl 3-(2-nitro-4-piperazin-2-ylphenyl)prop-2-enoate;hydrochloride |
| SMILES | CCOC(=O)C=Cc1ccc(C2CNCCN2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H19N3O4.ClH/c1-2-22-15(19)6-5-11-3-4-12(9-14(11)18(20)21)13-10-16-7-8-17-13;/h3-6,9,13,16-17H,2,7-8,10H2,1H3;1H |
| InChIKey | BUUSZTYNTQYQJP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|