C18H21NO3 — CID 70535624
2,2-dimethyl-4-[(6-phenyl-2-pyridinyl)oxy]pentanoic acid (PubChem CID 70535624) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2,2-dimethyl-4-[(6-phenyl-2-pyridinyl)oxy]pentanoic acid.
| Compound Name | 2,2-dimethyl-4-[(6-phenyl-2-pyridinyl)oxy]pentanoic acid |
|---|---|
| PubChem CID | 70535624 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2,2-dimethyl-4-[(6-phenyl-2-pyridinyl)oxy]pentanoic acid |
| SMILES | CC(CC(C)(C)C(=O)O)Oc1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H21NO3/c1-13(12-18(2,3)17(20)21)22-16-11-7-10-15(19-16)14-8-5-4-6-9-14/h4-11,13H,12H2,1-3H3,(H,20,21) |
| InChIKey | CKUQFTINFVYKJY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |