C15H16O6 — CID 70535649
1,5-bis(furan-2-yl)-3,3-bis(hydroxymethyl)penta-1,4-diene-2,4-diol (PubChem CID 70535649) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 1,5-bis(furan-2-yl)-3,3-bis(hydroxymethyl)penta-1,4-diene-2,4-diol.
| Compound Name | 1,5-bis(furan-2-yl)-3,3-bis(hydroxymethyl)penta-1,4-diene-2,4-diol |
|---|---|
| PubChem CID | 70535649 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1,5-bis(furan-2-yl)-3,3-bis(hydroxymethyl)penta-1,4-diene-2,4-diol |
| SMILES | OCC(CO)(C(O)=Cc1ccco1)C(O)=Cc1ccco1 |
| InChI | InChI=1S/C15H16O6/c16-9-15(10-17,13(18)7-11-3-1-5-20-11)14(19)8-12-4-2-6-21-12/h1-8,16-19H,9-10H2 |
| InChIKey | CNZDXNXKQPSVLD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|