C15H25N3O10S — CID 70535959
(2R)-1-(carboxymethyl)-2-[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]pyrrolidine-2-carboxylic acid;sulfuric acid (PubChem CID 70535959) has the molecular formula C15H25N3O10S and a molecular weight of 439.44 g/mol. Its IUPAC name is (2R)-1-(carboxymethyl)-2-[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]pyrrolidine-2-carboxylic acid;sulfuric acid.
| Compound Name | (2R)-1-(carboxymethyl)-2-[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]pyrrolidine-2-carboxylic acid;sulfuric acid |
|---|---|
| PubChem CID | 70535959 |
| Molecular Formula | C15H25N3O10S |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | (2R)-1-(carboxymethyl)-2-[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]propanoyl]pyrrolidine-2-carboxylic acid;sulfuric acid |
| SMILES | C[C@H](NC(=O)[C@@H]1CCCN1)C(=O)[C@@]1(C(=O)O)CCCN1CC(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C15H23N3O6.H2O4S/c1-9(17-13(22)10-4-2-6-16-10)12(21)15(14(23)24)5-3-7-18(15)8-11(19)20;1-5(2,3)4/h9-10,16H,2-8H2,1H3,(H,17,22)(H,19,20)(H,23,24);(H2,1,2,3,4)/t9-,10-,15+;/m0./s1 |
| InChIKey | OQGYPZWPSOJHPG-GQDNYMOCSA-N |
| XLogP | -1.84 |
| TPSA | 210.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|