C10H16N2O4 — CID 143102734
(3S)-4-oxo-3-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoic acid (PubChem CID 143102734) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is (3S)-4-oxo-3-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoic acid.
| Compound Name | (3S)-4-oxo-3-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 143102734 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (3S)-4-oxo-3-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoic acid |
| SMILES | CC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H16N2O4/c1-6(13)8(5-9(14)15)12-10(16)7-3-2-4-11-7/h7-8,11H,2-5H2,1H3,(H,12,16)(H,14,15)/t7-,8-/m0/s1 |
| InChIKey | XBUJTTFJOZUCOQ-YUMQZZPRSA-N |
| XLogP | -0.71 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |