C12H10Cl3NO2 — CID 70538548
5-chloro-1-(2,4-dichlorophenyl)-3,3-dimethylpyrrolidine-2,4-dione (PubChem CID 70538548) has the molecular formula C12H10Cl3NO2 and a molecular weight of 306.58 g/mol. Its IUPAC name is 5-chloro-1-(2,4-dichlorophenyl)-3,3-dimethylpyrrolidine-2,4-dione.
| Compound Name | 5-chloro-1-(2,4-dichlorophenyl)-3,3-dimethylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 70538548 |
| Molecular Formula | C12H10Cl3NO2 |
| Molecular Weight | 306.58 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 5-chloro-1-(2,4-dichlorophenyl)-3,3-dimethylpyrrolidine-2,4-dione |
| SMILES | CC1(C)C(=O)C(Cl)N(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C12H10Cl3NO2/c1-12(2)9(17)10(15)16(11(12)18)8-4-3-6(13)5-7(8)14/h3-5,10H,1-2H3 |
| InChIKey | KCJJEVVHCBKZFQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|