C36H38ClNO5 — CID 70540145
(Z)-but-2-enedioic acid;4-[4-[(4-chlorophenyl)methoxy]phenyl]-N-(3,3-diphenylpropyl)butan-2-amine (PubChem CID 70540145) has the molecular formula C36H38ClNO5 and a molecular weight of 600.16 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-[4-[(4-chlorophenyl)methoxy]phenyl]-N-(3,3-diphenylpropyl)butan-2-amine.
| Compound Name | (Z)-but-2-enedioic acid;4-[4-[(4-chlorophenyl)methoxy]phenyl]-N-(3,3-diphenylpropyl)butan-2-amine |
|---|---|
| PubChem CID | 70540145 |
| Molecular Formula | C36H38ClNO5 |
| Molecular Weight | 600.16 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-[4-[(4-chlorophenyl)methoxy]phenyl]-N-(3,3-diphenylpropyl)butan-2-amine |
| SMILES | CC(CCc1ccc(OCc2ccc(Cl)cc2)cc1)NCCC(c1ccccc1)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C32H34ClNO.C4H4O4/c1-25(34-23-22-32(28-8-4-2-5-9-28)29-10-6-3-7-11-29)12-13-26-16-20-31(21-17-26)35-24-27-14-18-30(33)19-15-27;5-3(6)1-2-4(7)8/h2-11,14-21,25,32,34H,12-13,22-24H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | QJBGVYYXWMKHJV-BTJKTKAUSA-N |
| XLogP | 7.76 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.16 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|