C16H24N4O2 — CID 70541096
4-[(6,7-dimethyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 70541096) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[(6,7-dimethyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-[(6,7-dimethyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 70541096 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 4-[(6,7-dimethyl-2,3-dihydro-1,4-benzodioxin-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCN(CC2COc3cc(C)c(C)cc3O2)CC1 |
| InChI | InChI=1S/C16H24N4O2/c1-11-7-14-15(8-12(11)2)22-13(10-21-14)9-19-3-5-20(6-4-19)16(17)18/h7-8,13H,3-6,9-10H2,1-2H3,(H3,17,18) |
| InChIKey | YGKWCIGSZSXPIF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|