C14H16N8O5S3 — CID 70541894
(6R,7S)-7-aminooxy-7-[[2-(cyanomethylsulfanyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 70541894) has the molecular formula C14H16N8O5S3 and a molecular weight of 472.53 g/mol. Its IUPAC name is (6R,7S)-7-aminooxy-7-[[2-(cyanomethylsulfanyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-7-aminooxy-7-[[2-(cyanomethylsulfanyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70541894 |
| Molecular Formula | C14H16N8O5S3 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | (6R,7S)-7-aminooxy-7-[[2-(cyanomethylsulfanyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Cn1nnnc1SCC1=C(C(=O)O)N2C(=O)[C@](NC(=O)CSCC#N)(ON)[C@H]2SC1 |
| InChI | InChI=1S/C14H16N8O5S3/c1-21-13(18-19-20-21)30-5-7-4-29-12-14(27-16,17-8(23)6-28-3-2-15)11(26)22(12)9(7)10(24)25/h12H,3-6,16H2,1H3,(H,17,23)(H,24,25)/t12-,14+/m1/s1 |
| InChIKey | WMXXQELDKDRGAE-OCCSQVGLSA-N |
| XLogP | -1.48 |
| TPSA | 189.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|