C22H28FNO2S2 — CID 70546339
3-benzylsulfanyl-N-[(2-fluorophenyl)methyl]-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]propanamide (PubChem CID 70546339) has the molecular formula C22H28FNO2S2 and a molecular weight of 421.60 g/mol. Its IUPAC name is 3-benzylsulfanyl-N-[(2-fluorophenyl)methyl]-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]propanamide.
| Compound Name | 3-benzylsulfanyl-N-[(2-fluorophenyl)methyl]-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 70546339 |
| Molecular Formula | C22H28FNO2S2 |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 3-benzylsulfanyl-N-[(2-fluorophenyl)methyl]-N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]propanamide |
| SMILES | CSCC[C@H](CO)N(Cc1ccccc1F)C(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C22H28FNO2S2/c1-27-13-11-20(16-25)24(15-19-9-5-6-10-21(19)23)22(26)12-14-28-17-18-7-3-2-4-8-18/h2-10,20,25H,11-17H2,1H3/t20-/m1/s1 |
| InChIKey | GOFVGARMYYHHPG-HXUWFJFHSA-N |
| XLogP | 4.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|