C12H14FNO2S — CID 24712234
2-(4-fluorophenyl)-3-(2-hydroxypropyl)-1,3-thiazolidin-4-one (PubChem CID 24712234) has the molecular formula C12H14FNO2S and a molecular weight of 255.31 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-(2-hydroxypropyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-fluorophenyl)-3-(2-hydroxypropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 24712234 |
| Molecular Formula | C12H14FNO2S |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-(4-fluorophenyl)-3-(2-hydroxypropyl)-1,3-thiazolidin-4-one |
| SMILES | CC(O)CN1C(=O)CSC1c1ccc(F)cc1 |
| InChI | InChI=1S/C12H14FNO2S/c1-8(15)6-14-11(16)7-17-12(14)9-2-4-10(13)5-3-9/h2-5,8,12,15H,6-7H2,1H3 |
| InChIKey | OLPXLSZEHVGDEA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |