C24H21ClO3 — CID 7054860
(7R)-15-chloro-7-(4-methoxyphenyl)-4,7-dimethyl-3,11-dioxatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2(6),4,12(17),13,15-hexaene (PubChem CID 7054860) has the molecular formula C24H21ClO3 and a molecular weight of 392.88 g/mol. Its IUPAC name is (7R)-15-chloro-7-(4-methoxyphenyl)-4,7-dimethyl-3,11-dioxatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2(6),4,12(17),13,15-hexaene.
| Compound Name | (7R)-15-chloro-7-(4-methoxyphenyl)-4,7-dimethyl-3,11-dioxatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2(6),4,12(17),13,15-hexaene |
|---|---|
| PubChem CID | 7054860 |
| Molecular Formula | C24H21ClO3 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (7R)-15-chloro-7-(4-methoxyphenyl)-4,7-dimethyl-3,11-dioxatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2(6),4,12(17),13,15-hexaene |
| SMILES | COc1ccc([C@@]2(C)CCc3oc4ccc(Cl)cc4c3-c3oc(C)cc32)cc1 |
| InChI | InChI=1S/C24H21ClO3/c1-14-12-19-23(27-14)22-18-13-16(25)6-9-20(18)28-21(22)10-11-24(19,2)15-4-7-17(26-3)8-5-15/h4-9,12-13H,10-11H2,1-3H3/t24-/m1/s1 |
| InChIKey | AKQYTWNPENOPLR-XMMPIXPASA-N |
| XLogP | 6.92 |
| TPSA | 35.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |