C21H19BrN5NaO6S2 — CID 70549972
sodium (6S,7R)-7-[(2-bromo-2-phenylacetyl)amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70549972) has the molecular formula C21H19BrN5NaO6S2 and a molecular weight of 604.44 g/mol. Its IUPAC name is sodium (6S,7R)-7-[(2-bromo-2-phenylacetyl)amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | sodium (6S,7R)-7-[(2-bromo-2-phenylacetyl)amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70549972 |
| Molecular Formula | C21H19BrN5NaO6S2 |
| Molecular Weight | 604.44 g/mol |
| Exact Mass | 602.99 |
| IUPAC Name | sodium (6S,7R)-7-[(2-bromo-2-phenylacetyl)amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCn1c(SCC2=C(C(=O)[O-])N3C(=O)[C@@H](NC(=O)C(Br)c4ccccc4)[C@@H]3SC2)n[nH]c(=O)c1=O.[Na+] |
| InChI | InChI=1S/C21H20BrN5O6S2.Na/c1-2-26-18(31)16(29)24-25-21(26)35-9-11-8-34-19-13(17(30)27(19)14(11)20(32)33)23-15(28)12(22)10-6-4-3-5-7-10;/h3-7,12-13,19H,2,8-9H2,1H3,(H,23,28)(H,24,29)(H,32,33);/q;+1/p-1/t12?,13-,19+;/m1./s1 |
| InChIKey | PBHUXCYMCYFBTD-FEFJUNICSA-M |
| XLogP | -3.41 |
| TPSA | 157.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.44 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|