C21H22N6O6S2 — CID 70548445
(6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 70548445) has the molecular formula C21H22N6O6S2 and a molecular weight of 518.58 g/mol. Its IUPAC name is (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70548445 |
| Molecular Formula | C21H22N6O6S2 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | (6R,7R)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCn1c(SCC2=C(C(=O)O)N3C(=O)[C@@H](NC(=O)[C@H](N)c4ccccc4)[C@H]3SC2)n[nH]c(=O)c1=O |
| InChI | InChI=1S/C21H22N6O6S2/c1-2-26-18(31)16(29)24-25-21(26)35-9-11-8-34-19-13(17(30)27(19)14(11)20(32)33)23-15(28)12(22)10-6-4-3-5-7-10/h3-7,12-13,19H,2,8-9,22H2,1H3,(H,23,28)(H,24,29)(H,32,33)/t12-,13-,19-/m1/s1 |
| InChIKey | ZCDXSKFCZLHNAV-VLXJIEOASA-N |
| XLogP | -0.52 |
| TPSA | 180.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|