C22H30N2O6 — CID 70553619
7-[(2S)-2-[(3-carboxy-3-phenylpropyl)amino]propanoyl]-1,3,4,4a,5,6,8,8a-octahydropyrano[3,4-c]pyridine-6-carboxylic acid (PubChem CID 70553619) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is 7-[(2S)-2-[(3-carboxy-3-phenylpropyl)amino]propanoyl]-1,3,4,4a,5,6,8,8a-octahydropyrano[3,4-c]pyridine-6-carboxylic acid.
| Compound Name | 7-[(2S)-2-[(3-carboxy-3-phenylpropyl)amino]propanoyl]-1,3,4,4a,5,6,8,8a-octahydropyrano[3,4-c]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 70553619 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 7-[(2S)-2-[(3-carboxy-3-phenylpropyl)amino]propanoyl]-1,3,4,4a,5,6,8,8a-octahydropyrano[3,4-c]pyridine-6-carboxylic acid |
| SMILES | C[C@H](NCCC(C(=O)O)c1ccccc1)C(=O)N1CC2COCCC2CC1C(=O)O |
| InChI | InChI=1S/C22H30N2O6/c1-14(23-9-7-18(21(26)27)15-5-3-2-4-6-15)20(25)24-12-17-13-30-10-8-16(17)11-19(24)22(28)29/h2-6,14,16-19,23H,7-13H2,1H3,(H,26,27)(H,28,29)/t14-,16?,17?,18?,19?/m0/s1 |
| InChIKey | VIIPFXFXNPXWNT-DHBQWTBNSA-N |
| XLogP | 1.56 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |