C15H22FN3O — CID 70557748
(2R)-6-[5-(cyclobutylamino)-2-fluorophenyl]-6-methylmorpholin-2-amine (PubChem CID 70557748) has the molecular formula C15H22FN3O and a molecular weight of 279.36 g/mol. Its IUPAC name is (2R)-6-[5-(cyclobutylamino)-2-fluorophenyl]-6-methylmorpholin-2-amine.
| Compound Name | (2R)-6-[5-(cyclobutylamino)-2-fluorophenyl]-6-methylmorpholin-2-amine |
|---|---|
| PubChem CID | 70557748 |
| Molecular Formula | C15H22FN3O |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (2R)-6-[5-(cyclobutylamino)-2-fluorophenyl]-6-methylmorpholin-2-amine |
| SMILES | CC1(c2cc(NC3CCC3)ccc2F)CNC[C@H](N)O1 |
| InChI | InChI=1S/C15H22FN3O/c1-15(9-18-8-14(17)20-15)12-7-11(5-6-13(12)16)19-10-3-2-4-10/h5-7,10,14,18-19H,2-4,8-9,17H2,1H3/t14-,15?/m1/s1 |
| InChIKey | XUXUMECXMDMGES-GICMACPYSA-N |
| XLogP | 1.91 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |