C27H44O2 — CID 70559187
(3R,8S,9S,10S,13S,14S,17R)-1-cyclopropyl-17-[(2S)-3-hydroxypentan-2-yl]-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-ol (PubChem CID 70559187) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is (3R,8S,9S,10S,13S,14S,17R)-1-cyclopropyl-17-[(2S)-3-hydroxypentan-2-yl]-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,8S,9S,10S,13S,14S,17R)-1-cyclopropyl-17-[(2S)-3-hydroxypentan-2-yl]-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 70559187 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | (3R,8S,9S,10S,13S,14S,17R)-1-cyclopropyl-17-[(2S)-3-hydroxypentan-2-yl]-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCC(O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](O)C=C(C5CC5)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44O2/c1-5-25(29)16(2)21-10-11-22-20-9-8-18-14-19(28)15-24(17-6-7-17)27(18,4)23(20)12-13-26(21,22)3/h15-23,25,28-29H,5-14H2,1-4H3/t16-,18?,19+,20-,21+,22-,23-,25?,26+,27-/m0/s1 |
| InChIKey | DBYJLKHHEPKKBF-KDJIOJFWSA-N |
| XLogP | 5.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|