C31H56Br2N2 — CID 70559848
bromomethane;1-[(5S,8S,9S,10S,13S,14S)-10,13-dimethyl-3-piperidin-1-yl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]piperidine (PubChem CID 70559848) has the molecular formula C31H56Br2N2 and a molecular weight of 616.61 g/mol. Its IUPAC name is bromomethane;1-[(5S,8S,9S,10S,13S,14S)-10,13-dimethyl-3-piperidin-1-yl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]piperidine.
| Compound Name | bromomethane;1-[(5S,8S,9S,10S,13S,14S)-10,13-dimethyl-3-piperidin-1-yl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]piperidine |
|---|---|
| PubChem CID | 70559848 |
| Molecular Formula | C31H56Br2N2 |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | bromomethane;1-[(5S,8S,9S,10S,13S,14S)-10,13-dimethyl-3-piperidin-1-yl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]piperidine |
| SMILES | CBr.CBr.C[C@@]12CCC[C@H]1[C@@H]1CC[C@H]3CC(N4CCCCC4)(N4CCCCC4)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C29H50N2.2CH3Br/c1-27-14-9-10-25(27)24-12-11-23-22-29(30-18-5-3-6-19-30,31-20-7-4-8-21-31)17-16-28(23,2)26(24)13-15-27;2*1-2/h23-26H,3-22H2,1-2H3;2*1H3/t23-,24-,25-,26-,27-,28-;;/m0../s1 |
| InChIKey | QWKBVGUEGQZDSS-ZVDSJWFWSA-N |
| XLogP | 9.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|