C29H37F3O7 — CID 70561291
[2-oxo-2-[(8S,9R,10S,13S,14S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethyl] butanoate (PubChem CID 70561291) has the molecular formula C29H37F3O7 and a molecular weight of 554.60 g/mol. Its IUPAC name is [2-oxo-2-[(8S,9R,10S,13S,14S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethyl] butanoate.
| Compound Name | [2-oxo-2-[(8S,9R,10S,13S,14S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethyl] butanoate |
|---|---|
| PubChem CID | 70561291 |
| Molecular Formula | C29H37F3O7 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | [2-oxo-2-[(8S,9R,10S,13S,14S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]ethyl] butanoate |
| SMILES | CCCC(=O)OCC(=O)[C@@]1(OC(=O)CC)C(C)C[C@H]2[C@@H]3CC(F)C4=C(F)C(=O)C=C[C@]4(C)[C@@]3(F)C(O)C[C@@]21C |
| InChI | InChI=1S/C29H37F3O7/c1-6-8-23(37)38-14-21(35)29(39-22(36)7-2)15(3)11-16-17-12-18(30)24-25(31)19(33)9-10-26(24,4)28(17,32)20(34)13-27(16,29)5/h9-10,15-18,20,34H,6-8,11-14H2,1-5H3/t15?,16-,17-,18?,20?,26-,27-,28-,29-/m0/s1 |
| InChIKey | CYOBNUBNIQPAHF-CAWMYXSPSA-N |
| XLogP | 4.45 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|