C26H33F3O6 — CID 22815560
ethyl (6S,8S,9R,10S,11S,13S,14S,16S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-16-propanoyloxy-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 22815560) has the molecular formula C26H33F3O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is ethyl (6S,8S,9R,10S,11S,13S,14S,16S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-16-propanoyloxy-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | ethyl (6S,8S,9R,10S,11S,13S,14S,16S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-16-propanoyloxy-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 22815560 |
| Molecular Formula | C26H33F3O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | ethyl (6S,8S,9R,10S,11S,13S,14S,16S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-16-propanoyloxy-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@]2(C)C[C@H](O)[C@@]3(F)[C@@H](C[C@H](F)C4=C(F)C(=O)C=C[C@@]43C)[C@@H]2C[C@]1(C)OC(=O)CC |
| InChI | InChI=1S/C26H33F3O6/c1-6-18(32)35-25(5)11-14-13-10-15(27)19-20(28)16(30)8-9-24(19,4)26(13,29)17(31)12-23(14,3)21(25)22(33)34-7-2/h8-9,13-15,17,21,31H,6-7,10-12H2,1-5H3/t13-,14-,15-,17-,21+,23-,24-,25-,26-/m0/s1 |
| InChIKey | UQEQFFCCRJHZBS-QSUNLNHUSA-N |
| XLogP | 4.10 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|