C25H31F3O5S — CID 88764706
O-ethyl (1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,17,19-trifluoro-11-hydroxy-6,6,9,13-tetramethyl-16-oxo-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate (PubChem CID 88764706) has the molecular formula C25H31F3O5S and a molecular weight of 500.58 g/mol. Its IUPAC name is O-ethyl (1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,17,19-trifluoro-11-hydroxy-6,6,9,13-tetramethyl-16-oxo-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate.
| Compound Name | O-ethyl (1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,17,19-trifluoro-11-hydroxy-6,6,9,13-tetramethyl-16-oxo-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate |
|---|---|
| PubChem CID | 88764706 |
| Molecular Formula | C25H31F3O5S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | O-ethyl (1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,17,19-trifluoro-11-hydroxy-6,6,9,13-tetramethyl-16-oxo-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate |
| SMILES | CCOC(=S)[C@@]12OC(C)(C)O[C@@H]1C[C@H]1[C@@H]3C[C@H](F)C4=C(F)C(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]12C |
| InChI | InChI=1S/C25H31F3O5S/c1-6-31-20(34)25-17(32-21(2,3)33-25)10-12-13-9-14(26)18-19(27)15(29)7-8-22(18,4)24(13,28)16(30)11-23(12,25)5/h7-8,12-14,16-17,30H,6,9-11H2,1-5H3/t12-,13-,14-,16-,17+,22-,23-,24-,25-/m0/s1 |
| InChIKey | KPIGRGSBUCOBNM-DGGCVGOHSA-N |
| XLogP | 4.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|