C29H31ClF2O5S — CID 88803900
O-phenyl (1S,2S,4R,8S,9S,11S,12R,13S,19S)-17-chloro-12,19-difluoro-11-hydroxy-6,6,9,13-tetramethyl-16-oxo-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate (PubChem CID 88803900) has the molecular formula C29H31ClF2O5S and a molecular weight of 565.08 g/mol. Its IUPAC name is O-phenyl (1S,2S,4R,8S,9S,11S,12R,13S,19S)-17-chloro-12,19-difluoro-11-hydroxy-6,6,9,13-tetramethyl-16-oxo-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate.
| Compound Name | O-phenyl (1S,2S,4R,8S,9S,11S,12R,13S,19S)-17-chloro-12,19-difluoro-11-hydroxy-6,6,9,13-tetramethyl-16-oxo-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate |
|---|---|
| PubChem CID | 88803900 |
| Molecular Formula | C29H31ClF2O5S |
| Molecular Weight | 565.08 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | O-phenyl (1S,2S,4R,8S,9S,11S,12R,13S,19S)-17-chloro-12,19-difluoro-11-hydroxy-6,6,9,13-tetramethyl-16-oxo-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-diene-8-carbothioate |
| SMILES | CC1(C)O[C@@H]2C[C@H]3[C@@H]4C[C@H](F)C5=C(Cl)C(=O)C=C[C@]5(C)[C@@]4(F)[C@@H](O)C[C@]3(C)[C@]2(C(=S)Oc2ccccc2)O1 |
| InChI | InChI=1S/C29H31ClF2O5S/c1-25(2)36-21-13-16-17-12-18(31)22-23(30)19(33)10-11-26(22,3)28(17,32)20(34)14-27(16,4)29(21,37-25)24(38)35-15-8-6-5-7-9-15/h5-11,16-18,20-21,34H,12-14H2,1-4H3/t16-,17-,18-,20-,21+,26-,27-,28-,29-/m0/s1 |
| InChIKey | QXLKINBRDKZCCQ-SLIARIMDSA-N |
| XLogP | 5.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.08 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|