C23H29ClF2O4S — CID 173452765
(4R,8R,9S,11S,12R,13S,19S)-17-chloro-12,19-difluoro-11-hydroxy-6,6,9,13,15-pentamethyl-8-sulfanyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 173452765) has the molecular formula C23H29ClF2O4S and a molecular weight of 475.00 g/mol. Its IUPAC name is (4R,8R,9S,11S,12R,13S,19S)-17-chloro-12,19-difluoro-11-hydroxy-6,6,9,13,15-pentamethyl-8-sulfanyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (4R,8R,9S,11S,12R,13S,19S)-17-chloro-12,19-difluoro-11-hydroxy-6,6,9,13,15-pentamethyl-8-sulfanyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 173452765 |
| Molecular Formula | C23H29ClF2O4S |
| Molecular Weight | 475.00 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | (4R,8R,9S,11S,12R,13S,19S)-17-chloro-12,19-difluoro-11-hydroxy-6,6,9,13,15-pentamethyl-8-sulfanyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CC1=C[C@@]2(C)C(=C(Cl)C1=O)[C@@H](F)CC1C3C[C@H]4OC(C)(C)O[C@@]4(S)[C@@]3(C)C[C@H](O)[C@@]12F |
| InChI | InChI=1S/C23H29ClF2O4S/c1-10-8-21(5)16(17(24)18(10)28)13(25)6-12-11-7-15-23(31,30-19(2,3)29-15)20(11,4)9-14(27)22(12,21)26/h8,11-15,27,31H,6-7,9H2,1-5H3/t11?,12?,13-,14-,15+,20-,21-,22-,23-/m0/s1 |
| InChIKey | BBCCGPYDJVALPE-DMDNVRCZSA-N |
| XLogP | 4.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.00 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|