C24H27F3O6 — CID 22815476
(6S,8S,9R,10S,13S,14S,16S,17R)-4,6,9-trifluoro-10,13,16-trimethyl-3,11-dioxo-17-propanoyloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 22815476) has the molecular formula C24H27F3O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is (6S,8S,9R,10S,13S,14S,16S,17R)-4,6,9-trifluoro-10,13,16-trimethyl-3,11-dioxo-17-propanoyloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (6S,8S,9R,10S,13S,14S,16S,17R)-4,6,9-trifluoro-10,13,16-trimethyl-3,11-dioxo-17-propanoyloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 22815476 |
| Molecular Formula | C24H27F3O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (6S,8S,9R,10S,13S,14S,16S,17R)-4,6,9-trifluoro-10,13,16-trimethyl-3,11-dioxo-17-propanoyloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CCC(=O)O[C@]1(C(=O)O)[C@@H](C)C[C@H]2[C@@H]3C[C@H](F)C4=C(F)C(=O)C=C[C@]4(C)[C@@]3(F)C(=O)C[C@@]21C |
| InChI | InChI=1S/C24H27F3O6/c1-5-17(30)33-24(20(31)32)11(2)8-12-13-9-14(25)18-19(26)15(28)6-7-21(18,3)23(13,27)16(29)10-22(12,24)4/h6-7,11-14H,5,8-10H2,1-4H3,(H,31,32)/t11-,12-,13-,14-,21-,22-,23-,24-/m0/s1 |
| InChIKey | DDMOMQFVVGLURQ-QKFNPTOYSA-N |
| XLogP | 3.83 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|