C23H29ClF2O4 — CID 22810555
[(6S,8S,9R,10S,11S,13S,14S,16R,17R)-4-chloro-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 22810555) has the molecular formula C23H29ClF2O4 and a molecular weight of 442.93 g/mol. Its IUPAC name is [(6S,8S,9R,10S,11S,13S,14S,16R,17R)-4-chloro-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(6S,8S,9R,10S,11S,13S,14S,16R,17R)-4-chloro-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 22810555 |
| Molecular Formula | C23H29ClF2O4 |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [(6S,8S,9R,10S,11S,13S,14S,16R,17R)-4-chloro-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1[C@H](C)C[C@H]2[C@@H]3C[C@H](F)C4=C(Cl)C(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C |
| InChI | InChI=1S/C23H29ClF2O4/c1-5-17(29)30-20-11(2)8-12-13-9-14(25)18-19(24)15(27)6-7-22(18,4)23(13,26)16(28)10-21(12,20)3/h6-7,11-14,16,20,28H,5,8-10H2,1-4H3/t11-,12+,13+,14+,16+,20-,21+,22+,23+/m1/s1 |
| InChIKey | RJFLHADJGDNZIF-ZHQVWJMLSA-N |
| XLogP | 4.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|