C22H27ClF2O4 — CID 22810560
[(6S,8S,9R,10S,11S,13S,14S,16R)-4-chloro-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl]methyl acetate (PubChem CID 22810560) has the molecular formula C22H27ClF2O4 and a molecular weight of 428.90 g/mol. Its IUPAC name is [(6S,8S,9R,10S,11S,13S,14S,16R)-4-chloro-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl]methyl acetate.
| Compound Name | [(6S,8S,9R,10S,11S,13S,14S,16R)-4-chloro-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl]methyl acetate |
|---|---|
| PubChem CID | 22810560 |
| Molecular Formula | C22H27ClF2O4 |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [(6S,8S,9R,10S,11S,13S,14S,16R)-4-chloro-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@H]2[C@@H]3C[C@H](F)C4=C(Cl)C(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)C1 |
| InChI | InChI=1S/C22H27ClF2O4/c1-11(26)29-10-12-6-13-14-7-15(24)18-19(23)16(27)4-5-21(18,3)22(14,25)17(28)9-20(13,2)8-12/h4-5,12-15,17,28H,6-10H2,1-3H3/t12-,13+,14+,15+,17+,20+,21+,22+/m1/s1 |
| InChIKey | FVAZFSKNSMIXHF-JSWOLJIJSA-N |
| XLogP | 4.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|