C28H37F3O6 — CID 22815584
tert-butyl (6S,8S,9R,10S,11S,13S,14S,16S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-16-propanoyloxy-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 22815584) has the molecular formula C28H37F3O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is tert-butyl (6S,8S,9R,10S,11S,13S,14S,16S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-16-propanoyloxy-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | tert-butyl (6S,8S,9R,10S,11S,13S,14S,16S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-16-propanoyloxy-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 22815584 |
| Molecular Formula | C28H37F3O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | tert-butyl (6S,8S,9R,10S,11S,13S,14S,16S,17R)-4,6,9-trifluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-16-propanoyloxy-6,7,8,11,12,14,15,17-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CCC(=O)O[C@@]1(C)C[C@H]2[C@@H]3C[C@H](F)C4=C(F)C(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H37F3O6/c1-8-19(34)36-27(7)12-15-14-11-16(29)20-21(30)17(32)9-10-26(20,6)28(14,31)18(33)13-25(15,5)22(27)23(35)37-24(2,3)4/h9-10,14-16,18,22,33H,8,11-13H2,1-7H3/t14-,15-,16-,18-,22+,25-,26-,27-,28-/m0/s1 |
| InChIKey | VOHJSMUNHYMSAG-ZYGVWQBQSA-N |
| XLogP | 4.88 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|