C27H34F2O5 — CID 68959087
[(6S,8S,9R,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-2-(4-hydroxybut-2-ynyl)-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 68959087) has the molecular formula C27H34F2O5 and a molecular weight of 476.56 g/mol. Its IUPAC name is [(6S,8S,9R,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-2-(4-hydroxybut-2-ynyl)-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(6S,8S,9R,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-2-(4-hydroxybut-2-ynyl)-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 68959087 |
| Molecular Formula | C27H34F2O5 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [(6S,8S,9R,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11-hydroxy-2-(4-hydroxybut-2-ynyl)-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](C)C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C(CC#CCO)=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C27H34F2O5/c1-5-23(33)34-24-15(2)10-17-18-11-20(28)19-12-21(31)16(8-6-7-9-30)13-26(19,4)27(18,29)22(32)14-25(17,24)3/h12-13,15,17-18,20,22,24,30,32H,5,8-11,14H2,1-4H3/t15-,17+,18+,20+,22+,24+,25+,26+,27+/m1/s1 |
| InChIKey | MYXPUCVCKDJVCG-HPSCPPAVSA-N |
| XLogP | 3.63 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|