C29H32F2O5 — CID 69015709
[(6S,8S,9R,10S,11S,13S,14S,16R,17S)-2-but-2-ynyl-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate (PubChem CID 69015709) has the molecular formula C29H32F2O5 and a molecular weight of 498.57 g/mol. Its IUPAC name is [(6S,8S,9R,10S,11S,13S,14S,16R,17S)-2-but-2-ynyl-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate.
| Compound Name | [(6S,8S,9R,10S,11S,13S,14S,16R,17S)-2-but-2-ynyl-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 69015709 |
| Molecular Formula | C29H32F2O5 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | [(6S,8S,9R,10S,11S,13S,14S,16R,17S)-2-but-2-ynyl-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
| SMILES | CC#CCC1=C[C@@]2(C)C(=CC1=O)[C@@H](F)C[C@H]1[C@@H]3C[C@@H](C)[C@H](OC(=O)c4ccco4)[C@@]3(C)C[C@H](O)[C@@]12F |
| InChI | InChI=1S/C29H32F2O5/c1-5-6-8-17-14-28(4)20(13-22(17)32)21(30)12-19-18-11-16(2)25(36-26(34)23-9-7-10-35-23)27(18,3)15-24(33)29(19,28)31/h7,9-10,13-14,16,18-19,21,24-25,33H,8,11-12,15H2,1-4H3/t16-,18+,19+,21+,24+,25+,27+,28+,29+/m1/s1 |
| InChIKey | LSKVBKHLRYBGLZ-SEGUOYBMSA-N |
| XLogP | 5.15 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|