C32H44N2O4 — CID 70564301
4-[N-[4-(N-but-2-enoyl-2,6-diethylanilino)butanoyl]-2,6-diethylanilino]butanoic acid (PubChem CID 70564301) has the molecular formula C32H44N2O4 and a molecular weight of 520.71 g/mol. Its IUPAC name is 4-[N-[4-(N-but-2-enoyl-2,6-diethylanilino)butanoyl]-2,6-diethylanilino]butanoic acid.
| Compound Name | 4-[N-[4-(N-but-2-enoyl-2,6-diethylanilino)butanoyl]-2,6-diethylanilino]butanoic acid |
|---|---|
| PubChem CID | 70564301 |
| Molecular Formula | C32H44N2O4 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | 4-[N-[4-(N-but-2-enoyl-2,6-diethylanilino)butanoyl]-2,6-diethylanilino]butanoic acid |
| SMILES | CC=CC(=O)N(CCCC(=O)N(CCCC(=O)O)c1c(CC)cccc1CC)c1c(CC)cccc1CC |
| InChI | InChI=1S/C32H44N2O4/c1-6-15-28(35)33(31-24(7-2)16-11-17-25(31)8-3)22-13-20-29(36)34(23-14-21-30(37)38)32-26(9-4)18-12-19-27(32)10-5/h6,11-12,15-19H,7-10,13-14,20-23H2,1-5H3,(H,37,38) |
| InChIKey | YLDBJQSKUUDEFZ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|