C26H31NO3 — CID 70565766
2-[3-[[2-hydroxy-1-(4-phenylmethoxyphenyl)ethyl]amino]-3-methylbutyl]phenol (PubChem CID 70565766) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[3-[[2-hydroxy-1-(4-phenylmethoxyphenyl)ethyl]amino]-3-methylbutyl]phenol.
| Compound Name | 2-[3-[[2-hydroxy-1-(4-phenylmethoxyphenyl)ethyl]amino]-3-methylbutyl]phenol |
|---|---|
| PubChem CID | 70565766 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 2-[3-[[2-hydroxy-1-(4-phenylmethoxyphenyl)ethyl]amino]-3-methylbutyl]phenol |
| SMILES | CC(C)(CCc1ccccc1O)NC(CO)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H31NO3/c1-26(2,17-16-22-10-6-7-11-25(22)29)27-24(18-28)21-12-14-23(15-13-21)30-19-20-8-4-3-5-9-20/h3-15,24,27-29H,16-19H2,1-2H3 |
| InChIKey | IOKBDTCNOIFDAG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |