C34H36N2O5 — CID 10554747
N,N'-bis[(1S)-2-hydroxy-1-phenylethyl]-2-methyl-2-[(4-phenylmethoxyphenyl)methyl]propanediamide (PubChem CID 10554747) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is N,N'-bis[(1S)-2-hydroxy-1-phenylethyl]-2-methyl-2-[(4-phenylmethoxyphenyl)methyl]propanediamide.
| Compound Name | N,N'-bis[(1S)-2-hydroxy-1-phenylethyl]-2-methyl-2-[(4-phenylmethoxyphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 10554747 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | N,N'-bis[(1S)-2-hydroxy-1-phenylethyl]-2-methyl-2-[(4-phenylmethoxyphenyl)methyl]propanediamide |
| SMILES | CC(Cc1ccc(OCc2ccccc2)cc1)(C(=O)N[C@H](CO)c1ccccc1)C(=O)N[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C34H36N2O5/c1-34(32(39)35-30(22-37)27-13-7-3-8-14-27,33(40)36-31(23-38)28-15-9-4-10-16-28)21-25-17-19-29(20-18-25)41-24-26-11-5-2-6-12-26/h2-20,30-31,37-38H,21-24H2,1H3,(H,35,39)(H,36,40)/t30-,31-/m1/s1 |
| InChIKey | ASNNWVJHBCRFRZ-FIRIVFDPSA-N |
| XLogP | 4.51 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|